![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| subsistance plantation ppt economic geog.pdf | 2024-10-23 06:33 | 266K | |
| ppt-1 steel and iron industry.pdf | 2024-10-23 06:33 | 1.2M | |
| ppt-2 engineering industry.pdf | 2024-10-23 06:33 | 429K | |
| Insolation, Atmospheric temperature and Heat Budget of the Earth.pdf | 2024-10-23 06:33 | 1.6M | |
| ppt unit 1 economic geography-converted.pdf | 2024-10-23 06:33 | 285K | |
| Environmental Geography_Virtual Workshop_Dr. Debjani Roy.pdf | 2024-10-23 06:33 | 1.1M | |
| Atmsphere- comosition nd structure.pdf | 2024-10-23 06:33 | 1.4M | |
| Atmospheric Humidity and Precipitation.pdf | 2024-10-23 06:33 | 921K | |
| Air, Atmospheric Pressure and Winds.pdf | 2024-10-23 06:33 | 2.8M | |
| Air Masses.pdf | 2024-10-23 06:33 | 1.0M | |